C22H24O3 — CID 102184317
3-(phenylmethoxymethyl)-1-(1-phenylmethoxypropa-1,2-dienyl)cyclobutan-1-ol (PubChem CID 102184317) has the molecular formula C22H24O3 and a molecular weight of 336.43 g/mol. Its IUPAC name is 3-(phenylmethoxymethyl)-1-(1-phenylmethoxypropa-1,2-dienyl)cyclobutan-1-ol.
| Compound Name | 3-(phenylmethoxymethyl)-1-(1-phenylmethoxypropa-1,2-dienyl)cyclobutan-1-ol |
|---|---|
| PubChem CID | 102184317 |
| Molecular Formula | C22H24O3 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 3-(phenylmethoxymethyl)-1-(1-phenylmethoxypropa-1,2-dienyl)cyclobutan-1-ol |
| SMILES | C=C=C(OCc1ccccc1)C1(O)CC(COCc2ccccc2)C1 |
| InChI | InChI=1S/C22H24O3/c1-2-21(25-17-19-11-7-4-8-12-19)22(23)13-20(14-22)16-24-15-18-9-5-3-6-10-18/h3-12,20,23H,1,13-17H2 |
| InChIKey | DRQOMQIRALGAFZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|