C30H39NO3Si — CID 132554177
(7S)-7-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-7-(2-phenylmethoxyethyl)pyrido[1,2-a]indol-6-one (PubChem CID 132554177) has the molecular formula C30H39NO3Si and a molecular weight of 489.73 g/mol. Its IUPAC name is (7S)-7-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-7-(2-phenylmethoxyethyl)pyrido[1,2-a]indol-6-one.
| Compound Name | (7S)-7-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-7-(2-phenylmethoxyethyl)pyrido[1,2-a]indol-6-one |
|---|---|
| PubChem CID | 132554177 |
| Molecular Formula | C30H39NO3Si |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | (7S)-7-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-7-(2-phenylmethoxyethyl)pyrido[1,2-a]indol-6-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCC[C@]1(CCOCc2ccccc2)C=Cc2cc3ccccc3n2C1=O |
| InChI | InChI=1S/C30H39NO3Si/c1-29(2,3)35(4,5)34-20-11-17-30(19-21-33-23-24-12-7-6-8-13-24)18-16-26-22-25-14-9-10-15-27(25)31(26)28(30)32/h6-10,12-16,18,22H,11,17,19-21,23H2,1-5H3/t30-/m1/s1 |
| InChIKey | HHQLNVXLNUUFHJ-SSEXGKCCSA-N |
| XLogP | 7.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|