C25H35NO3SSi — CID 102159661
tert-butyl-dimethyl-[4-[1-(4-methylphenyl)sulfonylindol-2-yl]butoxy]silane (PubChem CID 102159661) has the molecular formula C25H35NO3SSi and a molecular weight of 457.71 g/mol. Its IUPAC name is tert-butyl-dimethyl-[4-[1-(4-methylphenyl)sulfonylindol-2-yl]butoxy]silane.
| Compound Name | tert-butyl-dimethyl-[4-[1-(4-methylphenyl)sulfonylindol-2-yl]butoxy]silane |
|---|---|
| PubChem CID | 102159661 |
| Molecular Formula | C25H35NO3SSi |
| Molecular Weight | 457.71 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | tert-butyl-dimethyl-[4-[1-(4-methylphenyl)sulfonylindol-2-yl]butoxy]silane |
| SMILES | Cc1ccc(S(=O)(=O)n2c(CCCCO[Si](C)(C)C(C)(C)C)cc3ccccc32)cc1 |
| InChI | InChI=1S/C25H35NO3SSi/c1-20-14-16-23(17-15-20)30(27,28)26-22(19-21-11-7-8-13-24(21)26)12-9-10-18-29-31(5,6)25(2,3)4/h7-8,11,13-17,19H,9-10,12,18H2,1-6H3 |
| InChIKey | VIAUVIFNIVHEPL-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.71 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|