C16H26O3Si — CID 58168613
3-[2-[tert-butyl(dimethyl)silyl]oxyethoxymethyl]benzaldehyde (PubChem CID 58168613) has the molecular formula C16H26O3Si and a molecular weight of 294.47 g/mol. Its IUPAC name is 3-[2-[tert-butyl(dimethyl)silyl]oxyethoxymethyl]benzaldehyde.
| Compound Name | 3-[2-[tert-butyl(dimethyl)silyl]oxyethoxymethyl]benzaldehyde |
|---|---|
| PubChem CID | 58168613 |
| Molecular Formula | C16H26O3Si |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 3-[2-[tert-butyl(dimethyl)silyl]oxyethoxymethyl]benzaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OCCOCc1cccc(C=O)c1 |
| InChI | InChI=1S/C16H26O3Si/c1-16(2,3)20(4,5)19-10-9-18-13-15-8-6-7-14(11-15)12-17/h6-8,11-12H,9-10,13H2,1-5H3 |
| InChIKey | RWTKLKFDQOASQA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|