C28H41NO4Si — CID 131747384
4-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-2-(2-phenylmethoxyethyl)morpholin-3-one (PubChem CID 131747384) has the molecular formula C28H41NO4Si and a molecular weight of 483.73 g/mol. Its IUPAC name is 4-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-2-(2-phenylmethoxyethyl)morpholin-3-one.
| Compound Name | 4-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-2-(2-phenylmethoxyethyl)morpholin-3-one |
|---|---|
| PubChem CID | 131747384 |
| Molecular Formula | C28H41NO4Si |
| Molecular Weight | 483.73 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | 4-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-2-(2-phenylmethoxyethyl)morpholin-3-one |
| SMILES | CC1(CCOCc2ccccc2)OCC(CO[Si](C)(C)C(C)(C)C)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C28H41NO4Si/c1-27(2,3)34(5,6)33-22-25-21-32-28(4,17-18-31-20-24-15-11-8-12-16-24)26(30)29(25)19-23-13-9-7-10-14-23/h7-16,25H,17-22H2,1-6H3 |
| InChIKey | ZKEYNCNDKIAGOE-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.73 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|