C17H24O4S — CID 171963344
8,8-dioxo-3-(3-phenylmethoxypropyl)-8λ6-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171963344) has the molecular formula C17H24O4S and a molecular weight of 324.44 g/mol. Its IUPAC name is 8,8-dioxo-3-(3-phenylmethoxypropyl)-8λ6-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | 8,8-dioxo-3-(3-phenylmethoxypropyl)-8λ6-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171963344 |
| Molecular Formula | C17H24O4S |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 8,8-dioxo-3-(3-phenylmethoxypropyl)-8λ6-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | O=S1(=O)C2CCC1CC(O)(CCCOCc1ccccc1)C2 |
| InChI | InChI=1S/C17H24O4S/c18-17(11-15-7-8-16(12-17)22(15,19)20)9-4-10-21-13-14-5-2-1-3-6-14/h1-3,5-6,15-16,18H,4,7-13H2 |
| InChIKey | HEZSCUZRFCZULZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|