C16H22O4S — CID 171961182
9,9-dioxo-3-(2-phenoxyethyl)-9λ6-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171961182) has the molecular formula C16H22O4S and a molecular weight of 310.41 g/mol. Its IUPAC name is 9,9-dioxo-3-(2-phenoxyethyl)-9λ6-thiabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 9,9-dioxo-3-(2-phenoxyethyl)-9λ6-thiabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171961182 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 9,9-dioxo-3-(2-phenoxyethyl)-9λ6-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | O=S1(=O)C2CCCC1CC(O)(CCOc1ccccc1)C2 |
| InChI | InChI=1S/C16H22O4S/c17-16(9-10-20-13-5-2-1-3-6-13)11-14-7-4-8-15(12-16)21(14,18)19/h1-3,5-6,14-15,17H,4,7-12H2 |
| InChIKey | ICQSZFWCMRAFLA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |