C18H24O4S — CID 171940638
1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-3-phenylmethoxypropan-1-one (PubChem CID 171940638) has the molecular formula C18H24O4S and a molecular weight of 336.45 g/mol. Its IUPAC name is 1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-3-phenylmethoxypropan-1-one.
| Compound Name | 1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-3-phenylmethoxypropan-1-one |
|---|---|
| PubChem CID | 171940638 |
| Molecular Formula | C18H24O4S |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-3-phenylmethoxypropan-1-one |
| SMILES | O=C(CCOCc1ccccc1)C1CC2CCCC(C1)S2(=O)=O |
| InChI | InChI=1S/C18H24O4S/c19-18(9-10-22-13-14-5-2-1-3-6-14)15-11-16-7-4-8-17(12-15)23(16,20)21/h1-3,5-6,15-17H,4,7-13H2 |
| InChIKey | SBOONPFZMQOCBY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|