C34H58O4Si — CID 10816674
[(1R,2R,5R,8aR)-1-(hydroxymethyl)-5-methyl-5-(3-phenylmethoxypropyl)-1-[2-tri(propan-2-yl)silyloxyethyl]-2,3,6,7,8,8a-hexahydronaphthalen-2-yl]methanol (PubChem CID 10816674) has the molecular formula C34H58O4Si and a molecular weight of 558.92 g/mol. Its IUPAC name is [(1R,2R,5R,8aR)-1-(hydroxymethyl)-5-methyl-5-(3-phenylmethoxypropyl)-1-[2-tri(propan-2-yl)silyloxyethyl]-2,3,6,7,8,8a-hexahydronaphthalen-2-yl]methanol.
| Compound Name | [(1R,2R,5R,8aR)-1-(hydroxymethyl)-5-methyl-5-(3-phenylmethoxypropyl)-1-[2-tri(propan-2-yl)silyloxyethyl]-2,3,6,7,8,8a-hexahydronaphthalen-2-yl]methanol |
|---|---|
| PubChem CID | 10816674 |
| Molecular Formula | C34H58O4Si |
| Molecular Weight | 558.92 g/mol |
| Exact Mass | 558.41 |
| IUPAC Name | [(1R,2R,5R,8aR)-1-(hydroxymethyl)-5-methyl-5-(3-phenylmethoxypropyl)-1-[2-tri(propan-2-yl)silyloxyethyl]-2,3,6,7,8,8a-hexahydronaphthalen-2-yl]methanol |
| SMILES | CC(C)[Si](OCC[C@]1(CO)[C@H](CO)CC=C2[C@H]1CCC[C@]2(C)CCCOCc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C34H58O4Si/c1-26(2)39(27(3)4,28(5)6)38-22-20-34(25-36)30(23-35)16-17-31-32(34)15-11-18-33(31,7)19-12-21-37-24-29-13-9-8-10-14-29/h8-10,13-14,17,26-28,30,32,35-36H,11-12,15-16,18-25H2,1-7H3/t30-,32+,33+,34-/m0/s1 |
| InChIKey | QLTKKAQSOFJDKS-JZPVXCNCSA-N |
| XLogP | 8.29 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.92 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|