C35H54O6Si — CID 11714130
(2R,4Z,7R,8S)-7-[(4-methoxyphenyl)methoxy]-8-methyl-2-(phenylmethoxymethyl)-8-[2-tri(propan-2-yl)silyloxyethyl]-2,3,6,7-tetrahydrooxocin-3-ol (PubChem CID 11714130) has the molecular formula C35H54O6Si and a molecular weight of 598.90 g/mol. Its IUPAC name is (2R,4Z,7R,8S)-7-[(4-methoxyphenyl)methoxy]-8-methyl-2-(phenylmethoxymethyl)-8-[2-tri(propan-2-yl)silyloxyethyl]-2,3,6,7-tetrahydrooxocin-3-ol.
| Compound Name | (2R,4Z,7R,8S)-7-[(4-methoxyphenyl)methoxy]-8-methyl-2-(phenylmethoxymethyl)-8-[2-tri(propan-2-yl)silyloxyethyl]-2,3,6,7-tetrahydrooxocin-3-ol |
|---|---|
| PubChem CID | 11714130 |
| Molecular Formula | C35H54O6Si |
| Molecular Weight | 598.90 g/mol |
| Exact Mass | 598.37 |
| IUPAC Name | (2R,4Z,7R,8S)-7-[(4-methoxyphenyl)methoxy]-8-methyl-2-(phenylmethoxymethyl)-8-[2-tri(propan-2-yl)silyloxyethyl]-2,3,6,7-tetrahydrooxocin-3-ol |
| SMILES | COc1ccc(CO[C@@H]2C/C=C\C(O)[C@@H](COCc3ccccc3)O[C@@]2(C)CCO[Si](C(C)C)(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C35H54O6Si/c1-26(2)42(27(3)4,28(5)6)40-22-21-35(7)34(39-24-30-17-19-31(37-8)20-18-30)16-12-15-32(36)33(41-35)25-38-23-29-13-10-9-11-14-29/h9-15,17-20,26-28,32-34,36H,16,21-25H2,1-8H3/b15-12-/t32?,33-,34-,35+/m1/s1 |
| InChIKey | HZQBLJKPJCFWHR-WLGLGGFJSA-N |
| XLogP | 7.84 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.90 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|