C39H60O7Si — CID 11193188
2-[(1R,3S,5R,6S,8R,10S,12R,13S)-12-methyl-13-phenylmethoxy-12-(2-phenylmethoxyethyl)-5-tri(propan-2-yl)silyloxy-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-6-yl]ethanol (PubChem CID 11193188) has the molecular formula C39H60O7Si and a molecular weight of 668.99 g/mol. Its IUPAC name is 2-[(1R,3S,5R,6S,8R,10S,12R,13S)-12-methyl-13-phenylmethoxy-12-(2-phenylmethoxyethyl)-5-tri(propan-2-yl)silyloxy-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-6-yl]ethanol.
| Compound Name | 2-[(1R,3S,5R,6S,8R,10S,12R,13S)-12-methyl-13-phenylmethoxy-12-(2-phenylmethoxyethyl)-5-tri(propan-2-yl)silyloxy-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-6-yl]ethanol |
|---|---|
| PubChem CID | 11193188 |
| Molecular Formula | C39H60O7Si |
| Molecular Weight | 668.99 g/mol |
| Exact Mass | 668.41 |
| IUPAC Name | 2-[(1R,3S,5R,6S,8R,10S,12R,13S)-12-methyl-13-phenylmethoxy-12-(2-phenylmethoxyethyl)-5-tri(propan-2-yl)silyloxy-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-6-yl]ethanol |
| SMILES | CC(C)[Si](O[C@@H]1C[C@@H]2O[C@@H]3C[C@H](OCc4ccccc4)[C@@](C)(CCOCc4ccccc4)O[C@H]3C[C@H]2O[C@H]1CCO)(C(C)C)C(C)C |
| InChI | InChI=1S/C39H60O7Si/c1-27(2)47(28(3)4,29(5)6)46-37-23-34-33(43-32(37)18-20-40)22-36-35(44-34)24-38(42-26-31-16-12-9-13-17-31)39(7,45-36)19-21-41-25-30-14-10-8-11-15-30/h8-17,27-29,32-38,40H,18-26H2,1-7H3/t32-,33+,34-,35+,36-,37+,38-,39+/m0/s1 |
| InChIKey | RQJCGZOLBCWVQF-BXJRGKPSSA-N |
| XLogP | 7.98 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.99 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|