C38H56O7Si — CID 122207089
(1R,3S,6R,7S,9R,12S,14R,19S)-17,17-ditert-butyl-6-phenylmethoxy-7-(2-phenylmethoxyethyl)-2,8,13,16,18-pentaoxa-17-silatetracyclo[10.8.0.03,9.014,19]icosane (PubChem CID 122207089) has the molecular formula C38H56O7Si and a molecular weight of 652.95 g/mol. Its IUPAC name is (1R,3S,6R,7S,9R,12S,14R,19S)-17,17-ditert-butyl-6-phenylmethoxy-7-(2-phenylmethoxyethyl)-2,8,13,16,18-pentaoxa-17-silatetracyclo[10.8.0.03,9.014,19]icosane.
| Compound Name | (1R,3S,6R,7S,9R,12S,14R,19S)-17,17-ditert-butyl-6-phenylmethoxy-7-(2-phenylmethoxyethyl)-2,8,13,16,18-pentaoxa-17-silatetracyclo[10.8.0.03,9.014,19]icosane |
|---|---|
| PubChem CID | 122207089 |
| Molecular Formula | C38H56O7Si |
| Molecular Weight | 652.95 g/mol |
| Exact Mass | 652.38 |
| IUPAC Name | (1R,3S,6R,7S,9R,12S,14R,19S)-17,17-ditert-butyl-6-phenylmethoxy-7-(2-phenylmethoxyethyl)-2,8,13,16,18-pentaoxa-17-silatetracyclo[10.8.0.03,9.014,19]icosane |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)OC[C@H]2O[C@H]3CC[C@H]4O[C@@H](CCOCc5ccccc5)[C@H](OCc5ccccc5)CC[C@@H]4O[C@@H]3C[C@@H]2O1 |
| InChI | InChI=1S/C38H56O7Si/c1-37(2,3)46(38(4,5)6)41-26-36-35(45-46)23-34-32(44-36)20-19-30-31(43-34)18-17-29(40-25-28-15-11-8-12-16-28)33(42-30)21-22-39-24-27-13-9-7-10-14-27/h7-16,29-36H,17-26H2,1-6H3/t29-,30-,31+,32+,33+,34-,35+,36-/m1/s1 |
| InChIKey | DQAIUUJXPNYDKP-RKNMUDQRSA-N |
| XLogP | 7.89 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.95 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|