C35H42O6 — CID 122385504
(2S,3R,4aS,7S,9aR)-7-[(4-methoxyphenyl)methoxy]-6-methylidene-3-phenylmethoxy-2-(3-phenylmethoxypropyl)-2,3,4,4a,7,8,9,9a-octahydropyrano[3,2-b]oxepine (PubChem CID 122385504) has the molecular formula C35H42O6 and a molecular weight of 558.72 g/mol. Its IUPAC name is (2S,3R,4aS,7S,9aR)-7-[(4-methoxyphenyl)methoxy]-6-methylidene-3-phenylmethoxy-2-(3-phenylmethoxypropyl)-2,3,4,4a,7,8,9,9a-octahydropyrano[3,2-b]oxepine.
| Compound Name | (2S,3R,4aS,7S,9aR)-7-[(4-methoxyphenyl)methoxy]-6-methylidene-3-phenylmethoxy-2-(3-phenylmethoxypropyl)-2,3,4,4a,7,8,9,9a-octahydropyrano[3,2-b]oxepine |
|---|---|
| PubChem CID | 122385504 |
| Molecular Formula | C35H42O6 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | (2S,3R,4aS,7S,9aR)-7-[(4-methoxyphenyl)methoxy]-6-methylidene-3-phenylmethoxy-2-(3-phenylmethoxypropyl)-2,3,4,4a,7,8,9,9a-octahydropyrano[3,2-b]oxepine |
| SMILES | C=C1O[C@H]2C[C@@H](OCc3ccccc3)[C@H](CCCOCc3ccccc3)O[C@@H]2CC[C@@H]1OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C35H42O6/c1-26-31(38-25-29-15-17-30(36-2)18-16-29)19-20-33-35(40-26)22-34(39-24-28-12-7-4-8-13-28)32(41-33)14-9-21-37-23-27-10-5-3-6-11-27/h3-8,10-13,15-18,31-35H,1,9,14,19-25H2,2H3/t31-,32-,33+,34+,35-/m0/s1 |
| InChIKey | LAIYDKDIKOCXLT-NGFPHSLCSA-N |
| XLogP | 7.01 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|