C37H48O6 — CID 134998605
(7R)-3-[(4-methoxyphenyl)methoxy]-7-(phenylmethoxymethyl)-5-(8-phenylmethoxyoctyl)-6,8-dioxabicyclo[3.2.1]octane (PubChem CID 134998605) has the molecular formula C37H48O6 and a molecular weight of 588.79 g/mol. Its IUPAC name is (7R)-3-[(4-methoxyphenyl)methoxy]-7-(phenylmethoxymethyl)-5-(8-phenylmethoxyoctyl)-6,8-dioxabicyclo[3.2.1]octane.
| Compound Name | (7R)-3-[(4-methoxyphenyl)methoxy]-7-(phenylmethoxymethyl)-5-(8-phenylmethoxyoctyl)-6,8-dioxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 134998605 |
| Molecular Formula | C37H48O6 |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.35 |
| IUPAC Name | (7R)-3-[(4-methoxyphenyl)methoxy]-7-(phenylmethoxymethyl)-5-(8-phenylmethoxyoctyl)-6,8-dioxabicyclo[3.2.1]octane |
| SMILES | COc1ccc(COC2CC3OC(CCCCCCCCOCc4ccccc4)(C2)O[C@@H]3COCc2ccccc2)cc1 |
| InChI | InChI=1S/C37H48O6/c1-38-33-20-18-32(19-21-33)28-41-34-24-35-36(29-40-27-31-16-10-7-11-17-31)43-37(25-34,42-35)22-12-4-2-3-5-13-23-39-26-30-14-8-6-9-15-30/h6-11,14-21,34-36H,2-5,12-13,22-29H2,1H3/t34?,35?,36-,37?/m1/s1 |
| InChIKey | ZDJQKXLNCWZZCS-BPOCUFQESA-N |
| XLogP | 8.02 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|