C21H24O4 — CID 88524591
(1S,2S,3R,5R)-3-[(4-methoxyphenyl)methoxy]-2-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexane (PubChem CID 88524591) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is (1S,2S,3R,5R)-3-[(4-methoxyphenyl)methoxy]-2-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexane.
| Compound Name | (1S,2S,3R,5R)-3-[(4-methoxyphenyl)methoxy]-2-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 88524591 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (1S,2S,3R,5R)-3-[(4-methoxyphenyl)methoxy]-2-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexane |
| SMILES | COc1ccc(CO[C@@H]2C[C@H]3O[C@H]3[C@H]2COCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H24O4/c1-22-17-9-7-16(8-10-17)13-24-19-11-20-21(25-20)18(19)14-23-12-15-5-3-2-4-6-15/h2-10,18-21H,11-14H2,1H3/t18-,19+,20+,21-/m0/s1 |
| InChIKey | YEIIUMSXGQPMCC-BQJUDKOJSA-N |
| XLogP | 3.58 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|