C29H32O4 — CID 59434259
1-methoxy-4-[[(4S,5R)-4-phenylmethoxy-5-(phenylmethoxymethyl)cyclopenten-1-yl]methoxymethyl]benzene (PubChem CID 59434259) has the molecular formula C29H32O4 and a molecular weight of 444.57 g/mol. Its IUPAC name is 1-methoxy-4-[[(4S,5R)-4-phenylmethoxy-5-(phenylmethoxymethyl)cyclopenten-1-yl]methoxymethyl]benzene.
| Compound Name | 1-methoxy-4-[[(4S,5R)-4-phenylmethoxy-5-(phenylmethoxymethyl)cyclopenten-1-yl]methoxymethyl]benzene |
|---|---|
| PubChem CID | 59434259 |
| Molecular Formula | C29H32O4 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 1-methoxy-4-[[(4S,5R)-4-phenylmethoxy-5-(phenylmethoxymethyl)cyclopenten-1-yl]methoxymethyl]benzene |
| SMILES | COc1ccc(COCC2=CC[C@H](OCc3ccccc3)[C@H]2COCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H32O4/c1-30-27-15-12-25(13-16-27)19-31-21-26-14-17-29(33-20-24-10-6-3-7-11-24)28(26)22-32-18-23-8-4-2-5-9-23/h2-16,28-29H,17-22H2,1H3/t28-,29-/m0/s1 |
| InChIKey | GNPRQPSUIHOLTN-VMPREFPWSA-N |
| XLogP | 5.96 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|