C32H44O5 — CID 53483715
(2R,3R,5R)-2-[3-[(4-methoxyphenyl)methoxy]propyl]-3-methyl-5-[(3R,6S)-6-phenylmethoxy-3-propan-2-ylcyclohexen-1-yl]oxolan-3-ol (PubChem CID 53483715) has the molecular formula C32H44O5 and a molecular weight of 508.70 g/mol. Its IUPAC name is (2R,3R,5R)-2-[3-[(4-methoxyphenyl)methoxy]propyl]-3-methyl-5-[(3R,6S)-6-phenylmethoxy-3-propan-2-ylcyclohexen-1-yl]oxolan-3-ol.
| Compound Name | (2R,3R,5R)-2-[3-[(4-methoxyphenyl)methoxy]propyl]-3-methyl-5-[(3R,6S)-6-phenylmethoxy-3-propan-2-ylcyclohexen-1-yl]oxolan-3-ol |
|---|---|
| PubChem CID | 53483715 |
| Molecular Formula | C32H44O5 |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.32 |
| IUPAC Name | (2R,3R,5R)-2-[3-[(4-methoxyphenyl)methoxy]propyl]-3-methyl-5-[(3R,6S)-6-phenylmethoxy-3-propan-2-ylcyclohexen-1-yl]oxolan-3-ol |
| SMILES | COc1ccc(COCCC[C@H]2O[C@@H](C3=C[C@@H](C(C)C)CC[C@@H]3OCc3ccccc3)C[C@@]2(C)O)cc1 |
| InChI | InChI=1S/C32H44O5/c1-23(2)26-14-17-29(36-22-24-9-6-5-7-10-24)28(19-26)30-20-32(3,33)31(37-30)11-8-18-35-21-25-12-15-27(34-4)16-13-25/h5-7,9-10,12-13,15-16,19,23,26,29-31,33H,8,11,14,17-18,20-22H2,1-4H3/t26-,29-,30+,31+,32+/m0/s1 |
| InChIKey | KXUNWRQIGYPBQL-XAFFTLPBSA-N |
| XLogP | 6.48 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|