C28H36O6 — CID 134940137
1-[(2S)-6-[(4-methoxyphenyl)methoxy]-2-(3-phenylmethoxypropyl)-3,8-dioxabicyclo[5.1.1]nonan-4-yl]propan-1-one (PubChem CID 134940137) has the molecular formula C28H36O6 and a molecular weight of 468.59 g/mol. Its IUPAC name is 1-[(2S)-6-[(4-methoxyphenyl)methoxy]-2-(3-phenylmethoxypropyl)-3,8-dioxabicyclo[5.1.1]nonan-4-yl]propan-1-one.
| Compound Name | 1-[(2S)-6-[(4-methoxyphenyl)methoxy]-2-(3-phenylmethoxypropyl)-3,8-dioxabicyclo[5.1.1]nonan-4-yl]propan-1-one |
|---|---|
| PubChem CID | 134940137 |
| Molecular Formula | C28H36O6 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 1-[(2S)-6-[(4-methoxyphenyl)methoxy]-2-(3-phenylmethoxypropyl)-3,8-dioxabicyclo[5.1.1]nonan-4-yl]propan-1-one |
| SMILES | CCC(=O)C1CC(OCc2ccc(OC)cc2)C2CC(O2)[C@H](CCCOCc2ccccc2)O1 |
| InChI | InChI=1S/C28H36O6/c1-3-23(29)25-16-26(32-19-21-11-13-22(30-2)14-12-21)28-17-27(34-28)24(33-25)10-7-15-31-18-20-8-5-4-6-9-20/h4-6,8-9,11-14,24-28H,3,7,10,15-19H2,1-2H3/t24-,25?,26?,27?,28?/m0/s1 |
| InChIKey | JDTASLXEFVJSIM-GDAXPNNXSA-N |
| XLogP | 4.87 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|