C25H38O6Si — CID 11397088
ethyl (1R,3S,5S,6R,7S)-9,9-ditert-butyl-6-phenylmethoxy-2,8,10-trioxa-9-silatricyclo[5.4.0.03,5]undecane-4-carboxylate (PubChem CID 11397088) has the molecular formula C25H38O6Si and a molecular weight of 462.66 g/mol. Its IUPAC name is ethyl (1R,3S,5S,6R,7S)-9,9-ditert-butyl-6-phenylmethoxy-2,8,10-trioxa-9-silatricyclo[5.4.0.03,5]undecane-4-carboxylate.
| Compound Name | ethyl (1R,3S,5S,6R,7S)-9,9-ditert-butyl-6-phenylmethoxy-2,8,10-trioxa-9-silatricyclo[5.4.0.03,5]undecane-4-carboxylate |
|---|---|
| PubChem CID | 11397088 |
| Molecular Formula | C25H38O6Si |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | ethyl (1R,3S,5S,6R,7S)-9,9-ditert-butyl-6-phenylmethoxy-2,8,10-trioxa-9-silatricyclo[5.4.0.03,5]undecane-4-carboxylate |
| SMILES | CCOC(=O)C1[C@@H]2[C@@H](OCc3ccccc3)[C@@H]3O[Si](C(C)(C)C)(C(C)(C)C)OC[C@H]3O[C@H]12 |
| InChI | InChI=1S/C25H38O6Si/c1-8-27-23(26)19-18-21(19)30-17-15-29-32(24(2,3)4,25(5,6)7)31-20(17)22(18)28-14-16-12-10-9-11-13-16/h9-13,17-22H,8,14-15H2,1-7H3/t17-,18+,19?,20-,21+,22-/m1/s1 |
| InChIKey | RATVAFJERUAMCS-SNWQQKAYSA-N |
| XLogP | 4.61 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|