C27H37NO8SSi — CID 102418461
benzyl (1R,3R,8R,9S,10R,15S)-6,6-ditert-butyl-9-hydroxy-13-oxo-2,5,7,18-tetraoxa-11-thia-14-aza-6-silatetracyclo[8.8.0.03,8.012,17]octadec-12(17)-ene-15-carboxylate (PubChem CID 102418461) has the molecular formula C27H37NO8SSi and a molecular weight of 563.75 g/mol. Its IUPAC name is benzyl (1R,3R,8R,9S,10R,15S)-6,6-ditert-butyl-9-hydroxy-13-oxo-2,5,7,18-tetraoxa-11-thia-14-aza-6-silatetracyclo[8.8.0.03,8.012,17]octadec-12(17)-ene-15-carboxylate.
| Compound Name | benzyl (1R,3R,8R,9S,10R,15S)-6,6-ditert-butyl-9-hydroxy-13-oxo-2,5,7,18-tetraoxa-11-thia-14-aza-6-silatetracyclo[8.8.0.03,8.012,17]octadec-12(17)-ene-15-carboxylate |
|---|---|
| PubChem CID | 102418461 |
| Molecular Formula | C27H37NO8SSi |
| Molecular Weight | 563.75 g/mol |
| Exact Mass | 563.20 |
| IUPAC Name | benzyl (1R,3R,8R,9S,10R,15S)-6,6-ditert-butyl-9-hydroxy-13-oxo-2,5,7,18-tetraoxa-11-thia-14-aza-6-silatetracyclo[8.8.0.03,8.012,17]octadec-12(17)-ene-15-carboxylate |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)OC[C@H]2O[C@@H]3OC4=C(S[C@@H]3[C@@H](O)[C@H]2O1)C(=O)N[C@H](C(=O)OCc1ccccc1)C4 |
| InChI | InChI=1S/C27H37NO8SSi/c1-26(2,3)38(27(4,5)6)33-14-18-20(36-38)19(29)22-25(35-18)34-17-12-16(28-23(30)21(17)37-22)24(31)32-13-15-10-8-7-9-11-15/h7-11,16,18-20,22,25,29H,12-14H2,1-6H3,(H,28,30)/t16-,18+,19-,20-,22+,25-/m0/s1 |
| InChIKey | RQQHAYXQIZLRLK-BBYCCVEGSA-N |
| XLogP | 3.51 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.75 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|