C22H32O6Si — CID 11774482
(1S,2R,6S,7R,9R)-12,12-ditert-butyl-7-phenoxy-3,8,11,13-tetraoxa-12-silatricyclo[7.4.0.02,6]tridecan-4-one (PubChem CID 11774482) has the molecular formula C22H32O6Si and a molecular weight of 420.58 g/mol. Its IUPAC name is (1S,2R,6S,7R,9R)-12,12-ditert-butyl-7-phenoxy-3,8,11,13-tetraoxa-12-silatricyclo[7.4.0.02,6]tridecan-4-one.
| Compound Name | (1S,2R,6S,7R,9R)-12,12-ditert-butyl-7-phenoxy-3,8,11,13-tetraoxa-12-silatricyclo[7.4.0.02,6]tridecan-4-one |
|---|---|
| PubChem CID | 11774482 |
| Molecular Formula | C22H32O6Si |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | (1S,2R,6S,7R,9R)-12,12-ditert-butyl-7-phenoxy-3,8,11,13-tetraoxa-12-silatricyclo[7.4.0.02,6]tridecan-4-one |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)OC[C@H]2O[C@H](Oc3ccccc3)[C@H]3CC(=O)O[C@H]3[C@@H]2O1 |
| InChI | InChI=1S/C22H32O6Si/c1-21(2,3)29(22(4,5)6)24-13-16-19(28-29)18-15(12-17(23)27-18)20(26-16)25-14-10-8-7-9-11-14/h7-11,15-16,18-20H,12-13H2,1-6H3/t15-,16+,18+,19+,20-/m0/s1 |
| InChIKey | CJZVRESJOHRRSX-MSJBJCGKSA-N |
| XLogP | 4.18 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|