C29H46O3Si — CID 139254996
[(1S,9S,10R)-9-(2-phenylmethoxyethyl)-12-oxatricyclo[7.2.1.01,6]dodec-7-en-10-yl]oxy-tri(propan-2-yl)silane (PubChem CID 139254996) has the molecular formula C29H46O3Si and a molecular weight of 470.77 g/mol. Its IUPAC name is [(1S,9S,10R)-9-(2-phenylmethoxyethyl)-12-oxatricyclo[7.2.1.01,6]dodec-7-en-10-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(1S,9S,10R)-9-(2-phenylmethoxyethyl)-12-oxatricyclo[7.2.1.01,6]dodec-7-en-10-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 139254996 |
| Molecular Formula | C29H46O3Si |
| Molecular Weight | 470.77 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | [(1S,9S,10R)-9-(2-phenylmethoxyethyl)-12-oxatricyclo[7.2.1.01,6]dodec-7-en-10-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](O[C@@H]1C[C@@]23CCCCC2C=C[C@]1(CCOCc1ccccc1)O3)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H46O3Si/c1-22(2)33(23(3)4,24(5)6)31-27-20-29-16-11-10-14-26(29)15-17-28(27,32-29)18-19-30-21-25-12-8-7-9-13-25/h7-9,12-13,15,17,22-24,26-27H,10-11,14,16,18-21H2,1-6H3/t26?,27-,28-,29+/m1/s1 |
| InChIKey | SQTCWRFEALXNOU-OSKVWWJJSA-N |
| XLogP | 7.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.77 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|