C29H41NO2 — CID 10478136
2-[(1S,2R,3R,10S,13R,14S)-1-methyl-2-(3-phenylmethoxypropyl)-12-azatetracyclo[8.6.0.02,13.03,7]hexadeca-7,11-dien-14-yl]propan-2-ol (PubChem CID 10478136) has the molecular formula C29H41NO2 and a molecular weight of 435.65 g/mol. Its IUPAC name is 2-[(1S,2R,3R,10S,13R,14S)-1-methyl-2-(3-phenylmethoxypropyl)-12-azatetracyclo[8.6.0.02,13.03,7]hexadeca-7,11-dien-14-yl]propan-2-ol.
| Compound Name | 2-[(1S,2R,3R,10S,13R,14S)-1-methyl-2-(3-phenylmethoxypropyl)-12-azatetracyclo[8.6.0.02,13.03,7]hexadeca-7,11-dien-14-yl]propan-2-ol |
|---|---|
| PubChem CID | 10478136 |
| Molecular Formula | C29H41NO2 |
| Molecular Weight | 435.65 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | 2-[(1S,2R,3R,10S,13R,14S)-1-methyl-2-(3-phenylmethoxypropyl)-12-azatetracyclo[8.6.0.02,13.03,7]hexadeca-7,11-dien-14-yl]propan-2-ol |
| SMILES | CC(C)(O)[C@H]1CC[C@@]2(C)[C@H]3C=N[C@H]1[C@]2(CCCOCc1ccccc1)[C@@H]1CCCC1=CC3 |
| InChI | InChI=1S/C29H41NO2/c1-27(2,31)25-15-17-28(3)23-14-13-22-11-7-12-24(22)29(28,26(25)30-19-23)16-8-18-32-20-21-9-5-4-6-10-21/h4-6,9-10,13,19,23-26,31H,7-8,11-12,14-18,20H2,1-3H3/t23-,24-,25+,26-,28+,29+/m1/s1 |
| InChIKey | WXGBTACFYZJGAE-PIQYHTJOSA-N |
| XLogP | 6.36 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.65 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|