C21H34O2Si — CID 134982966
tert-butyl-dimethyl-[(E)-4-methylidene-7-phenylmethoxyhept-2-enoxy]silane (PubChem CID 134982966) has the molecular formula C21H34O2Si and a molecular weight of 346.59 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E)-4-methylidene-7-phenylmethoxyhept-2-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E)-4-methylidene-7-phenylmethoxyhept-2-enoxy]silane |
|---|---|
| PubChem CID | 134982966 |
| Molecular Formula | C21H34O2Si |
| Molecular Weight | 346.59 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | tert-butyl-dimethyl-[(E)-4-methylidene-7-phenylmethoxyhept-2-enoxy]silane |
| SMILES | C=C(/C=C/CO[Si](C)(C)C(C)(C)C)CCCOCc1ccccc1 |
| InChI | InChI=1S/C21H34O2Si/c1-19(13-11-17-23-24(5,6)21(2,3)4)12-10-16-22-18-20-14-8-7-9-15-20/h7-9,11,13-15H,1,10,12,16-18H2,2-6H3/b13-11+ |
| InChIKey | LMXCKCIHNYLKEB-ACCUITESSA-N |
| XLogP | 6.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.59 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|