C25H34O3 — CID 11485872
(2R)-5-[2-[(1S,2S,8aR)-1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-2-(furan-3-yl)-2,3-dihydropyran-6-one (PubChem CID 11485872) has the molecular formula C25H34O3 and a molecular weight of 382.54 g/mol. Its IUPAC name is (2R)-5-[2-[(1S,2S,8aR)-1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-2-(furan-3-yl)-2,3-dihydropyran-6-one.
| Compound Name | (2R)-5-[2-[(1S,2S,8aR)-1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-2-(furan-3-yl)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 11485872 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | (2R)-5-[2-[(1S,2S,8aR)-1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-2-(furan-3-yl)-2,3-dihydropyran-6-one |
| SMILES | C[C@H]1CC=C2[C@H](CCCC2(C)C)[C@@]1(C)CCC1=CC[C@H](c2ccoc2)OC1=O |
| InChI | InChI=1S/C25H34O3/c1-17-7-9-20-21(6-5-13-24(20,2)3)25(17,4)14-11-18-8-10-22(28-23(18)26)19-12-15-27-16-19/h8-9,12,15-17,21-22H,5-7,10-11,13-14H2,1-4H3/t17-,21-,22+,25-/m0/s1 |
| InChIKey | YTDDQHCVWDFMGO-OVSKJSCNSA-N |
| XLogP | 6.77 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|