C21H28O3 — CID 162868126
methyl 1-[2-(furan-3-yl)ethyl]-1,2-dimethyl-2,3,5,8,9,9a-hexahydrobenzo[7]annulene-6-carboxylate (PubChem CID 162868126) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is methyl 1-[2-(furan-3-yl)ethyl]-1,2-dimethyl-2,3,5,8,9,9a-hexahydrobenzo[7]annulene-6-carboxylate.
| Compound Name | methyl 1-[2-(furan-3-yl)ethyl]-1,2-dimethyl-2,3,5,8,9,9a-hexahydrobenzo[7]annulene-6-carboxylate |
|---|---|
| PubChem CID | 162868126 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | methyl 1-[2-(furan-3-yl)ethyl]-1,2-dimethyl-2,3,5,8,9,9a-hexahydrobenzo[7]annulene-6-carboxylate |
| SMILES | COC(=O)C1=CCCC2C(=CCC(C)C2(C)CCc2ccoc2)C1 |
| InChI | InChI=1S/C21H28O3/c1-15-7-8-17-13-18(20(22)23-3)5-4-6-19(17)21(15,2)11-9-16-10-12-24-14-16/h5,8,10,12,14-15,19H,4,6-7,9,11,13H2,1-3H3 |
| InChIKey | CZVZMXDHIOAILF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|