C25H36O2 — CID 11280115
(2R)-5-[2-[(1S,2R,4aR,8aR)-1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]ethyl]-2-(furan-3-yl)-3,6-dihydro-2H-pyran (PubChem CID 11280115) has the molecular formula C25H36O2 and a molecular weight of 368.56 g/mol. Its IUPAC name is (2R)-5-[2-[(1S,2R,4aR,8aR)-1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]ethyl]-2-(furan-3-yl)-3,6-dihydro-2H-pyran.
| Compound Name | (2R)-5-[2-[(1S,2R,4aR,8aR)-1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]ethyl]-2-(furan-3-yl)-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 11280115 |
| Molecular Formula | C25H36O2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (2R)-5-[2-[(1S,2R,4aR,8aR)-1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]ethyl]-2-(furan-3-yl)-3,6-dihydro-2H-pyran |
| SMILES | C=C1CCC[C@@H]2[C@@](C)(CCC3=CC[C@H](c4ccoc4)OC3)[C@H](C)CC[C@@]12C |
| InChI | InChI=1S/C25H36O2/c1-18-6-5-7-23-24(18,3)13-10-19(2)25(23,4)14-11-20-8-9-22(27-16-20)21-12-15-26-17-21/h8,12,15,17,19,22-23H,1,5-7,9-11,13-14,16H2,2-4H3/t19-,22-,23+,24+,25+/m1/s1 |
| InChIKey | JWRONCHLASWCIS-CPSSSWKVSA-N |
| XLogP | 7.25 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|