C25H36O3 — CID 22833146
3-[5-[2-[(1aS,5S,6S,8aS)-1a,5,6-trimethyl-1,2,3,4,4a,6,7,8-octahydrocyclopropa[e]naphthalen-5-yl]ethyl]-3,6-dihydro-2H-pyran-2-yl]-2H-furan-5-one (PubChem CID 22833146) has the molecular formula C25H36O3 and a molecular weight of 384.56 g/mol. Its IUPAC name is 3-[5-[2-[(1aS,5S,6S,8aS)-1a,5,6-trimethyl-1,2,3,4,4a,6,7,8-octahydrocyclopropa[e]naphthalen-5-yl]ethyl]-3,6-dihydro-2H-pyran-2-yl]-2H-furan-5-one.
| Compound Name | 3-[5-[2-[(1aS,5S,6S,8aS)-1a,5,6-trimethyl-1,2,3,4,4a,6,7,8-octahydrocyclopropa[e]naphthalen-5-yl]ethyl]-3,6-dihydro-2H-pyran-2-yl]-2H-furan-5-one |
|---|---|
| PubChem CID | 22833146 |
| Molecular Formula | C25H36O3 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | 3-[5-[2-[(1aS,5S,6S,8aS)-1a,5,6-trimethyl-1,2,3,4,4a,6,7,8-octahydrocyclopropa[e]naphthalen-5-yl]ethyl]-3,6-dihydro-2H-pyran-2-yl]-2H-furan-5-one |
| SMILES | C[C@H]1CC[C@@]23C[C@]2(C)CCCC3[C@@]1(C)CCC1=CCC(C2=CC(=O)OC2)OC1 |
| InChI | InChI=1S/C25H36O3/c1-17-8-12-25-16-23(25,2)10-4-5-21(25)24(17,3)11-9-18-6-7-20(27-14-18)19-13-22(26)28-15-19/h6,13,17,20-21H,4-5,7-12,14-16H2,1-3H3/t17-,20?,21?,23-,24-,25-/m0/s1 |
| InChIKey | WSXUGLGJEFCWAH-FEJBMKMJSA-N |
| XLogP | 5.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|