C20H28O6 — CID 163049296
3-[2-[(1S,2R,4R,5S,7R,10S,11R,12S)-2,4-dihydroxy-11,12-dimethyl-3,6-dioxatetracyclo[8.4.0.01,5.05,7]tetradecan-11-yl]ethyl]-2H-furan-5-one (PubChem CID 163049296) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is 3-[2-[(1S,2R,4R,5S,7R,10S,11R,12S)-2,4-dihydroxy-11,12-dimethyl-3,6-dioxatetracyclo[8.4.0.01,5.05,7]tetradecan-11-yl]ethyl]-2H-furan-5-one.
| Compound Name | 3-[2-[(1S,2R,4R,5S,7R,10S,11R,12S)-2,4-dihydroxy-11,12-dimethyl-3,6-dioxatetracyclo[8.4.0.01,5.05,7]tetradecan-11-yl]ethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 163049296 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 3-[2-[(1S,2R,4R,5S,7R,10S,11R,12S)-2,4-dihydroxy-11,12-dimethyl-3,6-dioxatetracyclo[8.4.0.01,5.05,7]tetradecan-11-yl]ethyl]-2H-furan-5-one |
| SMILES | C[C@H]1CC[C@@]23[C@H](O)O[C@@H](O)[C@]24O[C@@H]4CC[C@H]3[C@]1(C)CCC1=CC(=O)OC1 |
| InChI | InChI=1S/C20H28O6/c1-11-5-8-19-13(18(11,2)7-6-12-9-15(21)24-10-12)3-4-14-20(19,26-14)17(23)25-16(19)22/h9,11,13-14,16-17,22-23H,3-8,10H2,1-2H3/t11-,13-,14+,16+,17+,18+,19+,20-/m0/s1 |
| InChIKey | CYXRMZAZBZMBSL-SQEZEJOTSA-N |
| XLogP | 1.89 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|