C24H34O7 — CID 10812738
[(1S,5R,7S,10S,11R,12S)-4-ethoxy-11,12-dimethyl-11-[2-(5-oxo-2H-furan-3-yl)ethyl]-3,6-dioxatetracyclo[8.4.0.01,5.05,7]tetradecan-2-yl] acetate (PubChem CID 10812738) has the molecular formula C24H34O7 and a molecular weight of 434.53 g/mol. Its IUPAC name is [(1S,5R,7S,10S,11R,12S)-4-ethoxy-11,12-dimethyl-11-[2-(5-oxo-2H-furan-3-yl)ethyl]-3,6-dioxatetracyclo[8.4.0.01,5.05,7]tetradecan-2-yl] acetate.
| Compound Name | [(1S,5R,7S,10S,11R,12S)-4-ethoxy-11,12-dimethyl-11-[2-(5-oxo-2H-furan-3-yl)ethyl]-3,6-dioxatetracyclo[8.4.0.01,5.05,7]tetradecan-2-yl] acetate |
|---|---|
| PubChem CID | 10812738 |
| Molecular Formula | C24H34O7 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [(1S,5R,7S,10S,11R,12S)-4-ethoxy-11,12-dimethyl-11-[2-(5-oxo-2H-furan-3-yl)ethyl]-3,6-dioxatetracyclo[8.4.0.01,5.05,7]tetradecan-2-yl] acetate |
| SMILES | CCOC1OC(OC(C)=O)[C@@]23CC[C@H](C)[C@@](C)(CCC4=CC(=O)OC4)[C@@H]2CC[C@@H]2O[C@@]123 |
| InChI | InChI=1S/C24H34O7/c1-5-27-21-24-18(31-24)7-6-17-22(4,10-9-16-12-19(26)28-13-16)14(2)8-11-23(17,24)20(30-21)29-15(3)25/h12,14,17-18,20-21H,5-11,13H2,1-4H3/t14-,17-,18-,20?,21?,22+,23+,24+/m0/s1 |
| InChIKey | WXAZJVFQQIIKHF-VDEHURPMSA-N |
| XLogP | 3.50 |
| TPSA | 83.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|