C24H34O7 — CID 162973082
[8-acetyloxy-5,6-dimethyl-5-[2-(5-oxo-2H-furan-3-yl)ethyl]spiro[1,3,4,4a,6,7,8,8a-octahydronaphthalene-2,2'-oxirane]-1-yl]methyl acetate (PubChem CID 162973082) has the molecular formula C24H34O7 and a molecular weight of 434.53 g/mol. Its IUPAC name is [8-acetyloxy-5,6-dimethyl-5-[2-(5-oxo-2H-furan-3-yl)ethyl]spiro[1,3,4,4a,6,7,8,8a-octahydronaphthalene-2,2'-oxirane]-1-yl]methyl acetate.
| Compound Name | [8-acetyloxy-5,6-dimethyl-5-[2-(5-oxo-2H-furan-3-yl)ethyl]spiro[1,3,4,4a,6,7,8,8a-octahydronaphthalene-2,2'-oxirane]-1-yl]methyl acetate |
|---|---|
| PubChem CID | 162973082 |
| Molecular Formula | C24H34O7 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [8-acetyloxy-5,6-dimethyl-5-[2-(5-oxo-2H-furan-3-yl)ethyl]spiro[1,3,4,4a,6,7,8,8a-octahydronaphthalene-2,2'-oxirane]-1-yl]methyl acetate |
| SMILES | CC(=O)OCC1C2C(OC(C)=O)CC(C)C(C)(CCC3=CC(=O)OC3)C2CCC12CO2 |
| InChI | InChI=1S/C24H34O7/c1-14-9-20(31-16(3)26)22-18(23(14,4)7-5-17-10-21(27)29-11-17)6-8-24(13-30-24)19(22)12-28-15(2)25/h10,14,18-20,22H,5-9,11-13H2,1-4H3 |
| InChIKey | VDUBTHRPHOEQKW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|