C12H19NO2 — CID 79138649
[1-(aminomethyl)cyclohexyl]-(furan-3-yl)methanol (PubChem CID 79138649) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is [1-(aminomethyl)cyclohexyl]-(furan-3-yl)methanol.
| Compound Name | [1-(aminomethyl)cyclohexyl]-(furan-3-yl)methanol |
|---|---|
| PubChem CID | 79138649 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | [1-(aminomethyl)cyclohexyl]-(furan-3-yl)methanol |
| SMILES | NCC1(C(O)c2ccoc2)CCCCC1 |
| InChI | InChI=1S/C12H19NO2/c13-9-12(5-2-1-3-6-12)11(14)10-4-7-15-8-10/h4,7-8,11,14H,1-3,5-6,9,13H2 |
| InChIKey | TZYKPSRMBORQMD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |