C22H32O5 — CID 100956128
[(2Z,6Z,10Z)-6-formyl-2-(1-hydroxy-4-methylpent-3-enyl)-10-methyl-12-oxododeca-2,6,10-trienyl] acetate (PubChem CID 100956128) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is [(2Z,6Z,10Z)-6-formyl-2-(1-hydroxy-4-methylpent-3-enyl)-10-methyl-12-oxododeca-2,6,10-trienyl] acetate.
| Compound Name | [(2Z,6Z,10Z)-6-formyl-2-(1-hydroxy-4-methylpent-3-enyl)-10-methyl-12-oxododeca-2,6,10-trienyl] acetate |
|---|---|
| PubChem CID | 100956128 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | [(2Z,6Z,10Z)-6-formyl-2-(1-hydroxy-4-methylpent-3-enyl)-10-methyl-12-oxododeca-2,6,10-trienyl] acetate |
| SMILES | CC(=O)OC/C(=C/CC/C(C=O)=C/CC/C(C)=C\C=O)C(O)CC=C(C)C |
| InChI | InChI=1S/C22H32O5/c1-17(2)11-12-22(26)21(16-27-19(4)25)10-6-9-20(15-24)8-5-7-18(3)13-14-23/h8,10-11,13-15,22,26H,5-7,9,12,16H2,1-4H3/b18-13-,20-8-,21-10- |
| InChIKey | TVJYGSSUUWMVOX-MFRLNSLRSA-N |
| XLogP | 4.02 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|