C22H36O4 — CID 163062353
[12-hydroxy-7-(hydroxymethyl)-3,11,15-trimethylhexadeca-2,6,10,14-tetraenyl] acetate (PubChem CID 163062353) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is [12-hydroxy-7-(hydroxymethyl)-3,11,15-trimethylhexadeca-2,6,10,14-tetraenyl] acetate.
| Compound Name | [12-hydroxy-7-(hydroxymethyl)-3,11,15-trimethylhexadeca-2,6,10,14-tetraenyl] acetate |
|---|---|
| PubChem CID | 163062353 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | [12-hydroxy-7-(hydroxymethyl)-3,11,15-trimethylhexadeca-2,6,10,14-tetraenyl] acetate |
| SMILES | CC(=O)OCC=C(C)CCC=C(CO)CCC=C(C)C(O)CC=C(C)C |
| InChI | InChI=1S/C22H36O4/c1-17(2)12-13-22(25)19(4)9-7-11-21(16-23)10-6-8-18(3)14-15-26-20(5)24/h9-10,12,14,22-23,25H,6-8,11,13,15-16H2,1-5H3 |
| InChIKey | PQGMCBMSYRPHIV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|