C13H22O2 — CID 91999240
(5E)-7-hydroxy-6,10-dimethylundeca-5,9-dien-2-one (PubChem CID 91999240) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (5E)-7-hydroxy-6,10-dimethylundeca-5,9-dien-2-one.
| Compound Name | (5E)-7-hydroxy-6,10-dimethylundeca-5,9-dien-2-one |
|---|---|
| PubChem CID | 91999240 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (5E)-7-hydroxy-6,10-dimethylundeca-5,9-dien-2-one |
| SMILES | CC(=O)CC/C=C(\C)C(O)CC=C(C)C |
| InChI | InChI=1S/C13H22O2/c1-10(2)8-9-13(15)11(3)6-5-7-12(4)14/h6,8,13,15H,5,7,9H2,1-4H3/b11-6+ |
| InChIKey | DRPMNCHRRMKIHV-IZZDOVSWSA-N |
| XLogP | 3.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|