C24H38O5 — CID 122233939
dimethyl 2-[(2E,6E)-8-hydroxy-3,7-dimethylundeca-2,6,10-trienyl]-2-(4-methylpent-3-enyl)propanedioate (PubChem CID 122233939) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is dimethyl 2-[(2E,6E)-8-hydroxy-3,7-dimethylundeca-2,6,10-trienyl]-2-(4-methylpent-3-enyl)propanedioate.
| Compound Name | dimethyl 2-[(2E,6E)-8-hydroxy-3,7-dimethylundeca-2,6,10-trienyl]-2-(4-methylpent-3-enyl)propanedioate |
|---|---|
| PubChem CID | 122233939 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | dimethyl 2-[(2E,6E)-8-hydroxy-3,7-dimethylundeca-2,6,10-trienyl]-2-(4-methylpent-3-enyl)propanedioate |
| SMILES | C=CCC(O)/C(C)=C/CC/C(C)=C/CC(CCC=C(C)C)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C24H38O5/c1-8-11-21(25)20(5)14-9-13-19(4)15-17-24(22(26)28-6,23(27)29-7)16-10-12-18(2)3/h8,12,14-15,21,25H,1,9-11,13,16-17H2,2-7H3/b19-15+,20-14+ |
| InChIKey | OQPILMWVFZXLIP-YTOAGJIJSA-N |
| XLogP | 5.07 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|