C31H54O5Si — CID 122233931
dimethyl 2-[(2E,6E)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylundeca-2,6,10-trienyl]-2-[(E)-4-methylhex-3-enyl]propanedioate (PubChem CID 122233931) has the molecular formula C31H54O5Si and a molecular weight of 534.85 g/mol. Its IUPAC name is dimethyl 2-[(2E,6E)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylundeca-2,6,10-trienyl]-2-[(E)-4-methylhex-3-enyl]propanedioate.
| Compound Name | dimethyl 2-[(2E,6E)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylundeca-2,6,10-trienyl]-2-[(E)-4-methylhex-3-enyl]propanedioate |
|---|---|
| PubChem CID | 122233931 |
| Molecular Formula | C31H54O5Si |
| Molecular Weight | 534.85 g/mol |
| Exact Mass | 534.37 |
| IUPAC Name | dimethyl 2-[(2E,6E)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylundeca-2,6,10-trienyl]-2-[(E)-4-methylhex-3-enyl]propanedioate |
| SMILES | C=CCC(O[Si](C)(C)C(C)(C)C)/C(C)=C/CC/C(C)=C/CC(CC/C=C(\C)CC)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C31H54O5Si/c1-13-17-27(36-37(11,12)30(6,7)8)26(5)20-15-18-25(4)21-23-31(28(32)34-9,29(33)35-10)22-16-19-24(3)14-2/h13,19-21,27H,1,14-18,22-23H2,2-12H3/b24-19+,25-21+,26-20+ |
| InChIKey | JUDALADLICBCFF-OZRYMXIUSA-N |
| XLogP | 8.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.85 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|