C21H36O6Si — CID 102076883
dimethyl 2-[(E,4R)-4-acetyloxy-4-[tert-butyl(dimethyl)silyl]but-2-enyl]-2-but-3-enylpropanedioate (PubChem CID 102076883) has the molecular formula C21H36O6Si and a molecular weight of 412.60 g/mol. Its IUPAC name is dimethyl 2-[(E,4R)-4-acetyloxy-4-[tert-butyl(dimethyl)silyl]but-2-enyl]-2-but-3-enylpropanedioate.
| Compound Name | dimethyl 2-[(E,4R)-4-acetyloxy-4-[tert-butyl(dimethyl)silyl]but-2-enyl]-2-but-3-enylpropanedioate |
|---|---|
| PubChem CID | 102076883 |
| Molecular Formula | C21H36O6Si |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | dimethyl 2-[(E,4R)-4-acetyloxy-4-[tert-butyl(dimethyl)silyl]but-2-enyl]-2-but-3-enylpropanedioate |
| SMILES | C=CCCC(C/C=C/[C@H](OC(C)=O)[Si](C)(C)C(C)(C)C)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C21H36O6Si/c1-10-11-14-21(18(23)25-6,19(24)26-7)15-12-13-17(27-16(2)22)28(8,9)20(3,4)5/h10,12-13,17H,1,11,14-15H2,2-9H3/b13-12+/t17-/m1/s1 |
| InChIKey | DCBKAIZHRYKUCX-GZKZCVOOSA-N |
| XLogP | 4.21 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|