C10H17BrO2 — CID 101083243
(Z,7R,8R)-6-bromo-8-hydroxy-7-methylnon-5-en-2-one (PubChem CID 101083243) has the molecular formula C10H17BrO2 and a molecular weight of 249.15 g/mol. Its IUPAC name is (Z,7R,8R)-6-bromo-8-hydroxy-7-methylnon-5-en-2-one.
| Compound Name | (Z,7R,8R)-6-bromo-8-hydroxy-7-methylnon-5-en-2-one |
|---|---|
| PubChem CID | 101083243 |
| Molecular Formula | C10H17BrO2 |
| Molecular Weight | 249.15 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | (Z,7R,8R)-6-bromo-8-hydroxy-7-methylnon-5-en-2-one |
| SMILES | CC(=O)CC/C=C(\Br)[C@H](C)[C@@H](C)O |
| InChI | InChI=1S/C10H17BrO2/c1-7(12)5-4-6-10(11)8(2)9(3)13/h6,8-9,13H,4-5H2,1-3H3/b10-6-/t8-,9-/m1/s1 |
| InChIKey | IYXFRPMSDIZSIY-MNTZLAJPSA-N |
| XLogP | 2.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.15 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |