C20H30O3 — CID 143713877
2-[(2E,6E)-8-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]-4-methyl-2H-furan-5-one (PubChem CID 143713877) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is 2-[(2E,6E)-8-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]-4-methyl-2H-furan-5-one.
| Compound Name | 2-[(2E,6E)-8-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]-4-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 143713877 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 2-[(2E,6E)-8-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]-4-methyl-2H-furan-5-one |
| SMILES | CC(C)=CCC(O)/C(C)=C/CC/C(C)=C/CC1C=C(C)C(=O)O1 |
| InChI | InChI=1S/C20H30O3/c1-14(2)9-12-19(21)16(4)8-6-7-15(3)10-11-18-13-17(5)20(22)23-18/h8-10,13,18-19,21H,6-7,11-12H2,1-5H3/b15-10+,16-8+ |
| InChIKey | AAPXLNKQASAOKX-QJPCTQKWSA-N |
| XLogP | 4.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|