C16H24O4 — CID 10779138
4-[(3E)-5-hydroxy-4,8-dimethylnona-3,7-dienyl]-2-methoxy-2H-furan-5-one (PubChem CID 10779138) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 4-[(3E)-5-hydroxy-4,8-dimethylnona-3,7-dienyl]-2-methoxy-2H-furan-5-one.
| Compound Name | 4-[(3E)-5-hydroxy-4,8-dimethylnona-3,7-dienyl]-2-methoxy-2H-furan-5-one |
|---|---|
| PubChem CID | 10779138 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 4-[(3E)-5-hydroxy-4,8-dimethylnona-3,7-dienyl]-2-methoxy-2H-furan-5-one |
| SMILES | COC1C=C(CC/C=C(\C)C(O)CC=C(C)C)C(=O)O1 |
| InChI | InChI=1S/C16H24O4/c1-11(2)8-9-14(17)12(3)6-5-7-13-10-15(19-4)20-16(13)18/h6,8,10,14-15,17H,5,7,9H2,1-4H3/b12-6+ |
| InChIKey | KWJDQWGBHWFRJA-WUXMJOGZSA-N |
| XLogP | 2.89 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|