C14H22O2 — CID 101184082
2-[(2S)-2,6-dimethylhept-5-enyl]-2,3-dihydropyran-4-one (PubChem CID 101184082) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-[(2S)-2,6-dimethylhept-5-enyl]-2,3-dihydropyran-4-one.
| Compound Name | 2-[(2S)-2,6-dimethylhept-5-enyl]-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 101184082 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 2-[(2S)-2,6-dimethylhept-5-enyl]-2,3-dihydropyran-4-one |
| SMILES | CC(C)=CCC[C@H](C)CC1CC(=O)C=CO1 |
| InChI | InChI=1S/C14H22O2/c1-11(2)5-4-6-12(3)9-14-10-13(15)7-8-16-14/h5,7-8,12,14H,4,6,9-10H2,1-3H3/t12-,14?/m0/s1 |
| InChIKey | KDSPYOSKXOBFPM-NBFOIZRFSA-N |
| XLogP | 3.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|