C20H34O — CID 98172867
(2S,4aR,7R,8aS)-2-[(2S)-2,6-dimethylhept-5-enyl]-7-methyl-4-methylidene-2,3,4a,5,6,7,8,8a-octahydrochromene (PubChem CID 98172867) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is (2S,4aR,7R,8aS)-2-[(2S)-2,6-dimethylhept-5-enyl]-7-methyl-4-methylidene-2,3,4a,5,6,7,8,8a-octahydrochromene.
| Compound Name | (2S,4aR,7R,8aS)-2-[(2S)-2,6-dimethylhept-5-enyl]-7-methyl-4-methylidene-2,3,4a,5,6,7,8,8a-octahydrochromene |
|---|---|
| PubChem CID | 98172867 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | (2S,4aR,7R,8aS)-2-[(2S)-2,6-dimethylhept-5-enyl]-7-methyl-4-methylidene-2,3,4a,5,6,7,8,8a-octahydrochromene |
| SMILES | C=C1C[C@H](C[C@@H](C)CCC=C(C)C)O[C@H]2C[C@H](C)CC[C@H]12 |
| InChI | InChI=1S/C20H34O/c1-14(2)7-6-8-15(3)11-18-13-17(5)19-10-9-16(4)12-20(19)21-18/h7,15-16,18-20H,5-6,8-13H2,1-4H3/t15-,16+,18-,19+,20-/m0/s1 |
| InChIKey | NNOLCPLJEUHKPQ-ZRSLWSEBSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|