C40H76O4Si — CID 70184537
3,7-dimethyloct-6-enyl tris(5-methyl-2-propan-2-ylcyclohexyl) silicate (PubChem CID 70184537) has the molecular formula C40H76O4Si and a molecular weight of 649.13 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enyl tris(5-methyl-2-propan-2-ylcyclohexyl) silicate.
| Compound Name | 3,7-dimethyloct-6-enyl tris(5-methyl-2-propan-2-ylcyclohexyl) silicate |
|---|---|
| PubChem CID | 70184537 |
| Molecular Formula | C40H76O4Si |
| Molecular Weight | 649.13 g/mol |
| Exact Mass | 648.55 |
| IUPAC Name | 3,7-dimethyloct-6-enyl tris(5-methyl-2-propan-2-ylcyclohexyl) silicate |
| SMILES | CC(C)=CCCC(C)CCO[Si](OC1CC(C)CCC1C(C)C)(OC1CC(C)CCC1C(C)C)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C40H76O4Si/c1-27(2)14-13-15-31(9)22-23-41-45(42-38-24-32(10)16-19-35(38)28(3)4,43-39-25-33(11)17-20-36(39)29(5)6)44-40-26-34(12)18-21-37(40)30(7)8/h14,28-40H,13,15-26H2,1-12H3 |
| InChIKey | YCLHZNMZAUIXQB-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.13 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|