About CID 136711061
CID 136711061 (PubChem CID 136711061) has the molecular formula C14H31O2Si2
and a molecular weight of 287.57 g/mol.
Molecular Properties
| Compound Name | CID 136711061 |
| PubChem CID | 136711061 |
| Molecular Formula | C14H31O2Si2 |
| Molecular Weight | 287.57 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | — |
| SMILES | CC(C)=CCCC(C)CCO[Si](C)(C)O[Si](C)C |
| InChI | InChI=1S/C14H31O2Si2/c1-13(2)9-8-10-14(3)11-12-15-18(6,7)16-17(4)5/h9,14H,8,10-12H2,1-7H3 |
| InChIKey | BCAFXOSWRHMWFO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 136711061 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136711061?
The IUPAC name of CID 136711061 (CID 136711061) is not available.
What is the SMILES notation for CID 136711061?
The canonical SMILES for CID 136711061 is CC(C)=CCCC(C)CCO[Si](C)(C)O[Si](C)C.
What is the InChIKey of CID 136711061?
The InChIKey is BCAFXOSWRHMWFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31O2Si2/c1-13(2)9-8-10-14(3)11-12-15-18(6,7)16-17(4)5/h9,14H,8,10-12H2,1-7H3.
What are the key properties of CID 136711061?
CID 136711061 has a molecular weight of 287.57 g/mol, XLogP of 4.75, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136711061 is sourced from PubChem (CID 136711061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).