C26H38O6 — CID 163108186
5-hydroxy-5-[(2R,6E,10E)-13-(2-methoxy-5-oxo-2H-furan-4-yl)-2,6,10-trimethyltrideca-6,10-dienyl]-3-methylfuran-2-one (PubChem CID 163108186) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is 5-hydroxy-5-[(2R,6E,10E)-13-(2-methoxy-5-oxo-2H-furan-4-yl)-2,6,10-trimethyltrideca-6,10-dienyl]-3-methylfuran-2-one.
| Compound Name | 5-hydroxy-5-[(2R,6E,10E)-13-(2-methoxy-5-oxo-2H-furan-4-yl)-2,6,10-trimethyltrideca-6,10-dienyl]-3-methylfuran-2-one |
|---|---|
| PubChem CID | 163108186 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 5-hydroxy-5-[(2R,6E,10E)-13-(2-methoxy-5-oxo-2H-furan-4-yl)-2,6,10-trimethyltrideca-6,10-dienyl]-3-methylfuran-2-one |
| SMILES | COC1C=C(CC/C=C(\C)CC/C=C(\C)CCC[C@@H](C)CC2(O)C=C(C)C(=O)O2)C(=O)O1 |
| InChI | InChI=1S/C26H38O6/c1-18(11-7-13-20(3)16-26(29)17-21(4)24(27)32-26)9-6-10-19(2)12-8-14-22-15-23(30-5)31-25(22)28/h9,12,15,17,20,23,29H,6-8,10-11,13-14,16H2,1-5H3/b18-9+,19-12+/t20-,23?,26?/m1/s1 |
| InChIKey | DFJJMQJQONEJJJ-RFEGRCLASA-N |
| XLogP | 5.28 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|