C21H26O6 — CID 73043254
2-[2-[2-[3-(2-methoxy-4-methyl-5-oxofuran-2-yl)-2-methylprop-2-enyl]-5-oxo-2H-furan-4-yl]ethyl]-3-methylbut-2-enal (PubChem CID 73043254) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is 2-[2-[2-[3-(2-methoxy-4-methyl-5-oxofuran-2-yl)-2-methylprop-2-enyl]-5-oxo-2H-furan-4-yl]ethyl]-3-methylbut-2-enal.
| Compound Name | 2-[2-[2-[3-(2-methoxy-4-methyl-5-oxofuran-2-yl)-2-methylprop-2-enyl]-5-oxo-2H-furan-4-yl]ethyl]-3-methylbut-2-enal |
|---|---|
| PubChem CID | 73043254 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2-[2-[2-[3-(2-methoxy-4-methyl-5-oxofuran-2-yl)-2-methylprop-2-enyl]-5-oxo-2H-furan-4-yl]ethyl]-3-methylbut-2-enal |
| SMILES | COC1(C=C(C)CC2C=C(CCC(C=O)=C(C)C)C(=O)O2)C=C(C)C(=O)O1 |
| InChI | InChI=1S/C21H26O6/c1-13(2)17(12-22)7-6-16-9-18(26-20(16)24)8-14(3)10-21(25-5)11-15(4)19(23)27-21/h9-12,18H,6-8H2,1-5H3 |
| InChIKey | OVTFNRUPJPIJDK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|