C9H12O3 — CID 12997058
3,5-dimethyl-5-(2-oxopropyl)furan-2-one (PubChem CID 12997058) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 3,5-dimethyl-5-(2-oxopropyl)furan-2-one.
| Compound Name | 3,5-dimethyl-5-(2-oxopropyl)furan-2-one |
|---|---|
| PubChem CID | 12997058 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 3,5-dimethyl-5-(2-oxopropyl)furan-2-one |
| SMILES | CC(=O)CC1(C)C=C(C)C(=O)O1 |
| InChI | InChI=1S/C9H12O3/c1-6-4-9(3,5-7(2)10)12-8(6)11/h4H,5H2,1-3H3 |
| InChIKey | AKHREWINDWVGGJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |