C11H16O5 — CID 10823215
(5S)-5-(methoxymethyl)-3,3-dimethyl-5-(2-oxopropyl)oxolane-2,4-dione (PubChem CID 10823215) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is (5S)-5-(methoxymethyl)-3,3-dimethyl-5-(2-oxopropyl)oxolane-2,4-dione.
| Compound Name | (5S)-5-(methoxymethyl)-3,3-dimethyl-5-(2-oxopropyl)oxolane-2,4-dione |
|---|---|
| PubChem CID | 10823215 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (5S)-5-(methoxymethyl)-3,3-dimethyl-5-(2-oxopropyl)oxolane-2,4-dione |
| SMILES | COC[C@]1(CC(C)=O)OC(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C11H16O5/c1-7(12)5-11(6-15-4)8(13)10(2,3)9(14)16-11/h5-6H2,1-4H3/t11-/m0/s1 |
| InChIKey | JFGOXOLINNOQIK-NSHDSACASA-N |
| XLogP | 0.50 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|