C10H14O6 — CID 15358228
methyl (1R,4S,5S)-4-(methoxymethyl)-4,5-dimethyl-2-oxo-3,6-dioxabicyclo[3.1.0]hexane-1-carboxylate (PubChem CID 15358228) has the molecular formula C10H14O6 and a molecular weight of 230.22 g/mol. Its IUPAC name is methyl (1R,4S,5S)-4-(methoxymethyl)-4,5-dimethyl-2-oxo-3,6-dioxabicyclo[3.1.0]hexane-1-carboxylate.
| Compound Name | methyl (1R,4S,5S)-4-(methoxymethyl)-4,5-dimethyl-2-oxo-3,6-dioxabicyclo[3.1.0]hexane-1-carboxylate |
|---|---|
| PubChem CID | 15358228 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | methyl (1R,4S,5S)-4-(methoxymethyl)-4,5-dimethyl-2-oxo-3,6-dioxabicyclo[3.1.0]hexane-1-carboxylate |
| SMILES | COC[C@]1(C)OC(=O)[C@@]2(C(=O)OC)O[C@]21C |
| InChI | InChI=1S/C10H14O6/c1-8(5-13-3)9(2)10(16-9,6(11)14-4)7(12)15-8/h5H2,1-4H3/t8-,9-,10+/m0/s1 |
| InChIKey | DJZRTMMWNNMETA-LPEHRKFASA-N |
| XLogP | -0.35 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|